Products 162616-72-0
CAS 162616-72-0 appears in our catalog under these names: Lupichromone, Eriosemation. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 50mg, Get quote.
5,7-dihydroxy-6,8-bis(3-methylbut-2-enyl)chromen-4-one (CAS 162616-72-0) is a chemical compound with the molecular formula C19H22O4 and a molecular weight of 314.4 g/mol. IUPAC name: 5,7-dihydroxy-6,8-bis(3-methylbut-2-enyl)chromen-4-one. InChIKey: DNZGQFQVMYCNOP-UHFFFAOYSA-N.
| Molecular formula | C19H22O4 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | 5,7-dihydroxy-6,8-bis(3-methylbut-2-enyl)chromen-4-one |
| InChIKey | DNZGQFQVMYCNOP-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C(=C2C(=C1O)C(=O)C=CO2)CC=C(C)C)O)C |
Computed by PubChem (NCBI)