CAS 1186501-89-2 is the registry number for 1H-Pyrrolo[2,3-b]pyridine, 3-methyl-1-(phenylsulfonyl)-, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(benzenesulfonyl)-3-methylpyrrolo[2,3-b]pyridine (CAS 1186501-89-2) is a chemical compound with the molecular formula C14H12N2O2S and a molecular weight of 272.32 g/mol. IUPAC name: 1-(benzenesulfonyl)-3-methylpyrrolo[2,3-b]pyridine. InChIKey: HBDQEJSFPUINSB-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2S |
|---|---|
| Molecular weight | 272.32 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-3-methylpyrrolo[2,3-b]pyridine |
| InChIKey | HBDQEJSFPUINSB-UHFFFAOYSA-N |
| SMILES | CC1=CN(C2=C1C=CC=N2)S(=O)(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)