CAS 348640-02-8 appears in our catalog under these names: 1-Tosyl-1H-pyrrolo[2,3-b]pyridine, 98%, 1–Tosyl–1H–pyrrolo(2,3–b)pyridine, 1-Tosyl-1H-pyrrolo[2,3-b]pyridine 97%, 1-Tosyl-1H-pyrrolo[2,3-b]pyridine, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 100g, 250mg.
1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine (CAS 348640-02-8) is a chemical compound with the molecular formula C14H12N2O2S and a molecular weight of 272.32 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine. InChIKey: NSNZZTVUYQKEMX-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2S |
|---|---|
| Molecular weight | 272.32 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
| InChIKey | NSNZZTVUYQKEMX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C2N=CC=C3 |
Computed by PubChem (NCBI)