CAS 53514-41-3 is the registry number for 1-Benzoyl-3-(2-hydroxyphenyl)thiourea, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 25g, 5g, 250mg.
N-[(2-hydroxyphenyl)carbamothioyl]benzamide (CAS 53514-41-3) is a chemical compound with the molecular formula C14H12N2O2S and a molecular weight of 272.32 g/mol. IUPAC name: N-[(2-hydroxyphenyl)carbamothioyl]benzamide. InChIKey: RCKKAMQNVBUTBN-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2S |
|---|---|
| Molecular weight | 272.32 g/mol |
| IUPAC name | N-[(2-hydroxyphenyl)carbamothioyl]benzamide |
| InChIKey | RCKKAMQNVBUTBN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC(=S)NC2=CC=CC=C2O |
Computed by PubChem (NCBI)