CAS 896722-51-3 appears in our catalog under these names: 6-Methyl-1-(phenylsulfonyl)-1h-pyrrolo[2,3-b]pyridine, 95%, 6-Methyl-1-(phenylsulfonyl)-1H-pyrrolo(2,3-b)pyridine, 95%, 6–Methyl–1–(phenylsulfonyl)–1H–pyrrolo(2,3–b)pyridine, 6-Methyl-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine 95%. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 250mg, 5g.
1-(benzenesulfonyl)-6-methylpyrrolo[2,3-b]pyridine (CAS 896722-51-3) is a chemical compound with the molecular formula C14H12N2O2S and a molecular weight of 272.32 g/mol. IUPAC name: 1-(benzenesulfonyl)-6-methylpyrrolo[2,3-b]pyridine. InChIKey: HDYOJYIOAJSSBF-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2S |
|---|---|
| Molecular weight | 272.32 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-6-methylpyrrolo[2,3-b]pyridine |
| InChIKey | HDYOJYIOAJSSBF-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C=CN2S(=O)(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)