CAS 919747-26-5 appears in our catalog under these names: 2-(2,5-Dimethyl-1h-pyrrol-1-yl)-1,3-benzothiazole-6-carboxylic acid, 95%, 2-(2,5-Dimethyl-1H-pyrrol-1-yl)benzo(d)thiazole-6-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(2,5-dimethylpyrrol-1-yl)-1,3-benzothiazole-6-carboxylic acid (CAS 919747-26-5) is a chemical compound with the molecular formula C14H12N2O2S and a molecular weight of 272.32 g/mol. IUPAC name: 2-(2,5-dimethylpyrrol-1-yl)-1,3-benzothiazole-6-carboxylic acid. InChIKey: NZYHJAIQZLJSKC-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2S |
|---|---|
| Molecular weight | 272.32 g/mol |
| IUPAC name | 2-(2,5-dimethylpyrrol-1-yl)-1,3-benzothiazole-6-carboxylic acid |
| InChIKey | NZYHJAIQZLJSKC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=NC3=C(S2)C=C(C=C3)C(=O)O)C |
Computed by PubChem (NCBI)