Products 1187368-76-8
CAS 1187368-76-8 is the registry number for N-(4-Bromo-3-chlorophenyl)-N-methylacetamide, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
N-(4-bromo-3-chlorophenyl)-N-methylacetamide (CAS 1187368-76-8) is a chemical compound with the molecular formula C9H9BrClNO and a molecular weight of 262.53 g/mol. IUPAC name: N-(4-bromo-3-chlorophenyl)-N-methylacetamide. InChIKey: IEEGOBWFOKIIHH-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClNO |
|---|---|
| Molecular weight | 262.53 g/mol |
| IUPAC name | N-(4-bromo-3-chlorophenyl)-N-methylacetamide |
| InChIKey | IEEGOBWFOKIIHH-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C)C1=CC(=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)