CAS 1187582-44-0 is the registry number for 2-(2-Aminoethyl)-1H-1,3-benzodiazole-5-carboxylic acid dihydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(2-aminoethyl)-3H-benzimidazole-5-carboxylic acid;dihydrochloride (CAS 1187582-44-0) is a chemical compound with the molecular formula C10H13Cl2N3O2 and a molecular weight of 278.13 g/mol. IUPAC name: 2-(2-aminoethyl)-3H-benzimidazole-5-carboxylic acid;dihydrochloride. InChIKey: SPWLWROZLBMGFJ-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N3O2 |
|---|---|
| Molecular weight | 278.13 g/mol |
| IUPAC name | 2-(2-aminoethyl)-3H-benzimidazole-5-carboxylic acid;dihydrochloride |
| InChIKey | SPWLWROZLBMGFJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)NC(=N2)CCN.Cl.Cl |
Computed by PubChem (NCBI)