Products 764696-13-1
CAS 764696-13-1 is the registry number for N-Butyl-2-(4,5-dichloro-6-oxopyridazin-1(6H)-yl)acetamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-butyl-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide (CAS 764696-13-1) is a chemical compound with the molecular formula C10H13Cl2N3O2 and a molecular weight of 278.13 g/mol. IUPAC name: N-butyl-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide. InChIKey: LRUAONGUZQWNRM-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N3O2 |
|---|---|
| Molecular weight | 278.13 g/mol |
| IUPAC name | N-butyl-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide |
| InChIKey | LRUAONGUZQWNRM-UHFFFAOYSA-N |
| SMILES | CCCCNC(=O)CN1C(=O)C(=C(C=N1)Cl)Cl |
Computed by PubChem (NCBI)