Products 299425-71-1
CAS 299425-71-1 appears in our catalog under these names: 1-(4-Chloro-2-nitrophenyl)piperazine hydrochloride, 1-(4-Chloro-2-nitrophenyl)piperazine hydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2,5g, 250mg, 1g, 5g.
1-(4-chloro-2-nitrophenyl)piperazine;hydrochloride (CAS 299425-71-1) is a chemical compound with the molecular formula C10H13Cl2N3O2 and a molecular weight of 278.13 g/mol. IUPAC name: 1-(4-chloro-2-nitrophenyl)piperazine;hydrochloride. InChIKey: XYHXYXXVKQCEIC-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N3O2 |
|---|---|
| Molecular weight | 278.13 g/mol |
| IUPAC name | 1-(4-chloro-2-nitrophenyl)piperazine;hydrochloride |
| InChIKey | XYHXYXXVKQCEIC-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C=C(C=C2)Cl)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)