CAS 1616434-23-1 is the registry number for tert-Butyl (3-amino-2,6-dichloropyridin-4-yl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl N-(3-amino-2,6-dichloro-4-pyridinyl)carbamate (CAS 1616434-23-1) is a chemical compound with the molecular formula C10H13Cl2N3O2 and a molecular weight of 278.13 g/mol. IUPAC name: tert-butyl N-(3-amino-2,6-dichloro-4-pyridinyl)carbamate. InChIKey: XBCWWJVHFBRLEE-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N3O2 |
|---|---|
| Molecular weight | 278.13 g/mol |
| IUPAC name | tert-butyl N-(3-amino-2,6-dichloro-4-pyridinyl)carbamate |
| InChIKey | XBCWWJVHFBRLEE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=NC(=C1N)Cl)Cl |
Computed by PubChem (NCBI)