CAS 1803560-72-6 appears in our catalog under these names: 2-Amino-3-{1H-pyrrolo(3,2-b)pyridin-3-yl}propanoic acid dihydrochloride, 95%, 2-Amino-3-{1H-pyrrolo(3,2-b)pyridin-3-yl}propanoic acid dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-amino-3-(1H-pyrrolo[3,2-b]pyridin-3-yl)propanoic acid;dihydrochloride (CAS 1803560-72-6) is a chemical compound with the molecular formula C10H13Cl2N3O2 and a molecular weight of 278.13 g/mol. IUPAC name: 2-amino-3-(1H-pyrrolo[3,2-b]pyridin-3-yl)propanoic acid;dihydrochloride. InChIKey: JTXFLRYKLXMHHQ-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N3O2 |
|---|---|
| Molecular weight | 278.13 g/mol |
| IUPAC name | 2-amino-3-(1H-pyrrolo[3,2-b]pyridin-3-yl)propanoic acid;dihydrochloride |
| InChIKey | JTXFLRYKLXMHHQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CN2)CC(C(=O)O)N)N=C1.Cl.Cl |
Computed by PubChem (NCBI)