Products 1187631-03-3
CAS 1187631-03-3 is the registry number for 3-(3-Ethoxyphenyl)-1H-pyrazol-5-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-(3-ethoxyphenyl)-1H-pyrazol-3-amine;hydrochloride (CAS 1187631-03-3) is a chemical compound with the molecular formula C11H14ClN3O and a molecular weight of 239.70 g/mol. IUPAC name: 5-(3-ethoxyphenyl)-1H-pyrazol-3-amine;hydrochloride. InChIKey: YHTJVAXMUPDHPI-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | 5-(3-ethoxyphenyl)-1H-pyrazol-3-amine;hydrochloride |
| InChIKey | YHTJVAXMUPDHPI-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=CC(=C1)C2=CC(=NN2)N.Cl |
Computed by PubChem (NCBI)