CAS 1187928-30-8 appears in our catalog under these names: tert-Butyl 4-amino-3-methylpiperidine-1-carboxylate oxalate, 98%, tert-Butyl 4-amino-3-methylpiperidine-1-carboxylate oxalate, 95%, 95%, TERT-BUTYL 4-AMINO-3-METHYL-1-PIPERIDINECARBOXYLATE OXALATE, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 100mg, 250mg, 500mg, 1g.
Tert-butyl 4-amino-3-methylpiperidine-1-carboxylate;oxalic acid (CAS 1187928-30-8) is a chemical compound with the molecular formula C13H24N2O6 and a molecular weight of 304.34 g/mol. IUPAC name: tert-butyl 4-amino-3-methylpiperidine-1-carboxylate;oxalic acid. InChIKey: YAEXBFKJZMSPTD-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O6 |
|---|---|
| Molecular weight | 304.34 g/mol |
| IUPAC name | tert-butyl 4-amino-3-methylpiperidine-1-carboxylate;oxalic acid |
| InChIKey | YAEXBFKJZMSPTD-UHFFFAOYSA-N |
| SMILES | CC1CN(CCC1N)C(=O)OC(C)(C)C.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)