CAS 88971-40-8 appears in our catalog under these names: (S)-2,3-Bis((tert-butoxycarbonyl)amino)propanoic acid, 97%, (S)–2,3–Bis((tert–butoxycarbonyl)amino)propanoic acid, Boc-Dap(Boc)-OH 98%, (S)-2,3-Bis((Tert-Butoxycarbonyl)Amino)Propanoic Acid, 95%, 95%, Boc-Dap(Boc)-OH, 98.0%. Offered by: AmBeed, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 1g, 10g, 250mg, 500mg, 5g, 25g, 1 g.
(2S)-2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 88971-40-8) is a chemical compound with the molecular formula C13H24N2O6 and a molecular weight of 304.34 g/mol. IUPAC name: (2S)-2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: UDZLUXXCXDIIOK-QMMMGPOBSA-N.
| Molecular formula | C13H24N2O6 |
|---|---|
| Molecular weight | 304.34 g/mol |
| IUPAC name | (2S)-2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | UDZLUXXCXDIIOK-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)