Products 2504147-22-0

CAS 2504147-22-0 is the registry number for Cis-(rac)-1-n-boc-1,3-cyclohexyldiamine oxalate salt, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(1R,3S)-3-aminocyclohexyl]carbamate;oxalic acid (CAS 2504147-22-0) is a chemical compound with the molecular formula C13H24N2O6 and a molecular weight of 304.34 g/mol. IUPAC name: tert-butyl N-[(1R,3S)-3-aminocyclohexyl]carbamate;oxalic acid. InChIKey: LTNHHEIXYYIRHA-OULXEKPRSA-N.

Identity
Molecular formulaC13H24N2O6
Molecular weight304.34 g/mol
IUPAC nametert-butyl N-[(1R,3S)-3-aminocyclohexyl]carbamate;oxalic acid
InChIKeyLTNHHEIXYYIRHA-OULXEKPRSA-N
SMILESCC(C)(C)OC(=O)N[C@@H]1CCC[C@@H](C1)N.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)