CAS 159652-30-9 is the registry number for (R)-2,3-Bis((tert-butoxycarbonyl)amino)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
(2R)-2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 159652-30-9) is a chemical compound with the molecular formula C13H24N2O6 and a molecular weight of 304.34 g/mol. IUPAC name: (2R)-2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: UDZLUXXCXDIIOK-MRVPVSSYSA-N.
| Molecular formula | C13H24N2O6 |
|---|---|
| Molecular weight | 304.34 g/mol |
| IUPAC name | (2R)-2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | UDZLUXXCXDIIOK-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)