Products 2219419-37-9

CAS 2219419-37-9 is the registry number for Oxalic acid, tert-butyl 7-methyl-1,4-diazepane-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl 7-methyl-1,4-diazepane-1-carboxylate;oxalic acid (CAS 2219419-37-9) is a chemical compound with the molecular formula C13H24N2O6 and a molecular weight of 304.34 g/mol. IUPAC name: tert-butyl 7-methyl-1,4-diazepane-1-carboxylate;oxalic acid. InChIKey: CZINXETWCAHZMQ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H24N2O6
Molecular weight304.34 g/mol
IUPAC nametert-butyl 7-methyl-1,4-diazepane-1-carboxylate;oxalic acid
InChIKeyCZINXETWCAHZMQ-UHFFFAOYSA-N
SMILESCC1CCNCCN1C(=O)OC(C)(C)C.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)