CAS 1187932-00-8 appears in our catalog under these names: Pyrazolo(1,5-a)pyridin-3-ylmethanamine dihydrochloride, 96%, Pyrazolo[1,5-a]pyridine-3-methanamine, hydrochloride (1:2), 95%, 95%, Pyrazolo[1,5-a]pyridine-3-methanamine dihydrochloride, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g.
Pyrazolo[1,5-a]pyridin-3-ylmethanamine;dihydrochloride (CAS 1187932-00-8) is a chemical compound with the molecular formula C8H11Cl2N3 and a molecular weight of 220.10 g/mol. IUPAC name: pyrazolo[1,5-a]pyridin-3-ylmethanamine;dihydrochloride. InChIKey: IYDFIGRTKJXLJD-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2N3 |
|---|---|
| Molecular weight | 220.10 g/mol |
| IUPAC name | pyrazolo[1,5-a]pyridin-3-ylmethanamine;dihydrochloride |
| InChIKey | IYDFIGRTKJXLJD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=NN2C=C1)CN.Cl.Cl |
Computed by PubChem (NCBI)