CAS 1187932-50-8 appears in our catalog under these names: 1–(Pyridin–3–yl)cyclopropanamine dihydrochloride, 1-(Pyridin-3-yl)cyclopropanamine dihydrochloride, 95%, 95%, 1-(Pyridin-3-yl)cyclopropanamine dihydrochloride, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg.
1-pyridin-3-ylcyclopropan-1-amine;dihydrochloride (CAS 1187932-50-8) is a chemical compound with the molecular formula C8H12Cl2N2 and a molecular weight of 207.10 g/mol. IUPAC name: 1-pyridin-3-ylcyclopropan-1-amine;dihydrochloride. InChIKey: CTOQLERDGYBWAV-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N2 |
|---|---|
| Molecular weight | 207.10 g/mol |
| IUPAC name | 1-pyridin-3-ylcyclopropan-1-amine;dihydrochloride |
| InChIKey | CTOQLERDGYBWAV-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CN=CC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)