Products 1187932-59-7
CAS 1187932-59-7 appears in our catalog under these names: 1,7-Naphthyridin-8-amine hydrochloride, 95%, 1,7-Naphthyridin-8-amine, hydrochloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1,7-naphthyridin-8-amine;hydrochloride (CAS 1187932-59-7) is a chemical compound with the molecular formula C8H8ClN3 and a molecular weight of 181.62 g/mol. IUPAC name: 1,7-naphthyridin-8-amine;hydrochloride. InChIKey: SAQSIHJPAQGIDE-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 1,7-naphthyridin-8-amine;hydrochloride |
| InChIKey | SAQSIHJPAQGIDE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=NC=C2)N)N=C1.Cl |
Computed by PubChem (NCBI)