Products 1187933-29-4
CAS 1187933-29-4 appears in our catalog under these names: 1–(4–Chlorophenyl)azetidine–3–carboxylic acid, 1-(4-Chlorophenyl)azetidine-3-carboxylic acid, 98%, 1-(4-Chlorophenyl)azetidine-3-carboxylic acid, 95%, 1-(4-Chlorophenyl)azetidine-3-carboxylic acid, 95%, 95%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 50mg, 5g.
1-(4-chlorophenyl)azetidine-3-carboxylic acid (CAS 1187933-29-4) is a chemical compound with the molecular formula C10H10ClNO2 and a molecular weight of 211.64 g/mol. IUPAC name: 1-(4-chlorophenyl)azetidine-3-carboxylic acid. InChIKey: JZXZRZQJWQECTJ-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO2 |
|---|---|
| Molecular weight | 211.64 g/mol |
| IUPAC name | 1-(4-chlorophenyl)azetidine-3-carboxylic acid |
| InChIKey | JZXZRZQJWQECTJ-UHFFFAOYSA-N |
| SMILES | C1C(CN1C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)