CAS 1187968-09-7 is the registry number for 4,4-Difluorochroman-6-amine. Offered by: TRC. Available pack sizes: 2,5g.
4,4-difluoro-2,3-dihydrochromen-6-amine (CAS 1187968-09-7) is a chemical compound with the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. IUPAC name: 4,4-difluoro-2,3-dihydrochromen-6-amine. InChIKey: LWMQRVULTNRTIC-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO |
|---|---|
| Molecular weight | 185.17 g/mol |
| IUPAC name | 4,4-difluoro-2,3-dihydrochromen-6-amine |
| InChIKey | LWMQRVULTNRTIC-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1(F)F)C=C(C=C2)N |
Computed by PubChem (NCBI)