Products 1188044-87-2
CAS 1188044-87-2 is the registry number for 2-(6-Fluoro-2,3-dihydro-1H-inden-1-yl)acetic acid, 95%. Offered by: Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g.
2-(6-fluoro-2,3-dihydro-1H-inden-1-yl)acetic acid (CAS 1188044-87-2) is a chemical compound with the molecular formula C11H11FO2 and a molecular weight of 194.20 g/mol. IUPAC name: 2-(6-fluoro-2,3-dihydro-1H-inden-1-yl)acetic acid. InChIKey: LHUYQQXFPZPNDL-UHFFFAOYSA-N.
| Molecular formula | C11H11FO2 |
|---|---|
| Molecular weight | 194.20 g/mol |
| IUPAC name | 2-(6-fluoro-2,3-dihydro-1H-inden-1-yl)acetic acid |
| InChIKey | LHUYQQXFPZPNDL-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1CC(=O)O)C=C(C=C2)F |
Computed by PubChem (NCBI)