Products 2323068-61-5
CAS 2323068-61-5 is the registry number for (S)-5,7-Dichloro-2,3-dihydro-1H-inden-1-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-5,7-dichloro-2,3-dihydro-1H-inden-1-ol (CAS 2323068-61-5) is a chemical compound with the molecular formula C9H8Cl2O and a molecular weight of 203.06 g/mol. IUPAC name: (1S)-5,7-dichloro-2,3-dihydro-1H-inden-1-ol. InChIKey: MSBZPTHVBLQOPJ-QMMMGPOBSA-N.
| Molecular formula | C9H8Cl2O |
|---|---|
| Molecular weight | 203.06 g/mol |
| IUPAC name | (1S)-5,7-dichloro-2,3-dihydro-1H-inden-1-ol |
| InChIKey | MSBZPTHVBLQOPJ-QMMMGPOBSA-N |
| SMILES | C1CC2=C([C@H]1O)C(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)