Products 118939-09-6
CAS 118939-09-6 appears in our catalog under these names: 2-Methyl-4-(methylsulfonyl)benzoic acid, 97%, 2-Methyl-4-(methylsulfonyl)benzoic acid, 98%, 2–Methyl–4–(methylsulfonyl)benzoic Acid, 2-Methyl-4-(methylsulfonyl)benzoic acid, >97%, >97%, 2-Methyl-4-(methylsulfonyl)benzoic acid, >97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-methyl-4-methylsulfonylbenzoic acid (CAS 118939-09-6) is a chemical compound with the molecular formula C9H10O4S and a molecular weight of 214.24 g/mol. IUPAC name: 2-methyl-4-methylsulfonylbenzoic acid. InChIKey: WEKZLBGODVDBBZ-UHFFFAOYSA-N.
| Molecular formula | C9H10O4S |
|---|---|
| Molecular weight | 214.24 g/mol |
| IUPAC name | 2-methyl-4-methylsulfonylbenzoic acid |
| InChIKey | WEKZLBGODVDBBZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)S(=O)(=O)C)C(=O)O |
Computed by PubChem (NCBI)