Products 51522-22-6
CAS 51522-22-6 appears in our catalog under these names: 4-Methyl-3-(methylsulfonyl)benzoic acid, 98%, 3-Methanesulfonyl-4-methylbenzoic acid, 4-Methyl-3-(methylsulfonyl)benzoic acid 98%, 4-Methyl-3-(methylsulfonyl)benzoic acid, 98%, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 5g, 25g, 0,5g, 100mg.
4-methyl-3-methylsulfonylbenzoic acid (CAS 51522-22-6) is a chemical compound with the molecular formula C9H10O4S and a molecular weight of 214.24 g/mol. IUPAC name: 4-methyl-3-methylsulfonylbenzoic acid. InChIKey: IYIOTRUPYRIVLP-UHFFFAOYSA-N.
| Molecular formula | C9H10O4S |
|---|---|
| Molecular weight | 214.24 g/mol |
| IUPAC name | 4-methyl-3-methylsulfonylbenzoic acid |
| InChIKey | IYIOTRUPYRIVLP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)S(=O)(=O)C |
Computed by PubChem (NCBI)