CAS 199535-00-7 appears in our catalog under these names: 4-(Methanesulfonylmethyl)benzoic acid, 98%, 4-((Methylsulfonyl)methyl)benzoic acid, 98%, 4-(Methylsulfonylmethyl)benzoic acid, 4-(METHANESULFONYLMETHYL)BENZOIC ACID, 98%, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 5g, 250mg, 2,5g, 100mg.
4-(methylsulfonylmethyl)benzoic acid (CAS 199535-00-7) is a chemical compound with the molecular formula C9H10O4S and a molecular weight of 214.24 g/mol. IUPAC name: 4-(methylsulfonylmethyl)benzoic acid. InChIKey: HPGPGXQMPNJNPV-UHFFFAOYSA-N.
| Molecular formula | C9H10O4S |
|---|---|
| Molecular weight | 214.24 g/mol |
| IUPAC name | 4-(methylsulfonylmethyl)benzoic acid |
| InChIKey | HPGPGXQMPNJNPV-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)