Products 70158-52-0

CAS 70158-52-0 is the registry number for Dimethyl 3-thienylmalonate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Dimethyl 2-thiophen-3-ylpropanedioate (CAS 70158-52-0) is a chemical compound with the molecular formula C9H10O4S and a molecular weight of 214.24 g/mol. IUPAC name: dimethyl 2-thiophen-3-ylpropanedioate. InChIKey: NAWKBJDDFVZPNQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10O4S
Molecular weight214.24 g/mol
IUPAC namedimethyl 2-thiophen-3-ylpropanedioate
InChIKeyNAWKBJDDFVZPNQ-UHFFFAOYSA-N
SMILESCOC(=O)C(C1=CSC=C1)C(=O)OC

Computed by PubChem (NCBI)