CAS 3937-96-0 appears in our catalog under these names: 4-Toluenesulfonylacetic acid, 98%, 2–(p–Toluenesulfonyl)acetic Acid, p-Toluenesulfonylacetic acid, 98% , 2-(p-Toluenesulfonyl)acetic Acid, >98.0%(HPLC), 2-Tosylacetic acid 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
2-(4-methylphenyl)sulfonylacetic acid (CAS 3937-96-0) is a chemical compound with the molecular formula C9H10O4S and a molecular weight of 214.24 g/mol. IUPAC name: 2-(4-methylphenyl)sulfonylacetic acid. InChIKey: AQDHXMBUTDLAMD-UHFFFAOYSA-N.
| Molecular formula | C9H10O4S |
|---|---|
| Molecular weight | 214.24 g/mol |
| IUPAC name | 2-(4-methylphenyl)sulfonylacetic acid |
| InChIKey | AQDHXMBUTDLAMD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)CC(=O)O |
Computed by PubChem (NCBI)