Products 1189427-82-4
CAS 1189427-82-4 appears in our catalog under these names: 6-Methoxy-2-naphthaleneacetic Acid-d3 (Desmethyl Naproxen-d3), Desmethyl Naproxen–d3, Desmethyl Naproxen-d3, 98.0%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 1 mg.
2-[6-(trideuteriomethoxy)naphthalen-2-yl]acetic acid (CAS 1189427-82-4) is a chemical compound with the molecular formula C13H12O3 and a molecular weight of 219.25 g/mol. IUPAC name: 2-[6-(trideuteriomethoxy)naphthalen-2-yl]acetic acid. InChIKey: PHJFLPMVEFKEPL-FIBGUPNXSA-N.
| Molecular formula | C13H12O3 |
|---|---|
| Molecular weight | 219.25 g/mol |
| IUPAC name | 2-[6-(trideuteriomethoxy)naphthalen-2-yl]acetic acid |
| InChIKey | PHJFLPMVEFKEPL-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC2=C(C=C1)C=C(C=C2)CC(=O)O |
Computed by PubChem (NCBI)