CAS 1189434-97-6 is the registry number for 2-(2-(Trifluoromethyl)phenyl)-pyrrolidine Hydrochloride. Offered by: TRC. Available pack sizes: 250mg.
2-[2-(trifluoromethyl)phenyl]pyrrolidine;hydrochloride (CAS 1189434-97-6) is a chemical compound with the molecular formula C11H13ClF3N and a molecular weight of 251.67 g/mol. IUPAC name: 2-[2-(trifluoromethyl)phenyl]pyrrolidine;hydrochloride. InChIKey: APDMORWJFZBMEX-UHFFFAOYSA-N.
| Molecular formula | C11H13ClF3N |
|---|---|
| Molecular weight | 251.67 g/mol |
| IUPAC name | 2-[2-(trifluoromethyl)phenyl]pyrrolidine;hydrochloride |
| InChIKey | APDMORWJFZBMEX-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=CC=CC=C2C(F)(F)F.Cl |
Computed by PubChem (NCBI)