CAS 1391392-07-6 appears in our catalog under these names: (S)-2-(2-(Trifluoromethyl)phenyl)pyrrolidine (hydrochloride), 95%, 95%, (S)-2-(2-(Trifluoromethyl)phenyl)pyrrolidine (hydrochloride), 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
(2S)-2-[2-(trifluoromethyl)phenyl]pyrrolidine;hydrochloride (CAS 1391392-07-6) is a chemical compound with the molecular formula C11H13ClF3N and a molecular weight of 251.67 g/mol. IUPAC name: (2S)-2-[2-(trifluoromethyl)phenyl]pyrrolidine;hydrochloride. InChIKey: APDMORWJFZBMEX-PPHPATTJSA-N.
| Molecular formula | C11H13ClF3N |
|---|---|
| Molecular weight | 251.67 g/mol |
| IUPAC name | (2S)-2-[2-(trifluoromethyl)phenyl]pyrrolidine;hydrochloride |
| InChIKey | APDMORWJFZBMEX-PPHPATTJSA-N |
| SMILES | C1C[C@H](NC1)C2=CC=CC=C2C(F)(F)F.Cl |
Computed by PubChem (NCBI)