CAS 1391384-41-0 appears in our catalog under these names: (R)-2-(2-(TRIFLUOROMETHYL)PHENYL)PYRROLIDINE HCL, 95%, (R)-2-(2-(Trifluoromethyl)phenyl)pyrrolidine hcl, 98%, 98%, (R)-2-(2-(TRIFLUOROMETHYL)PHENYL)PYRROLIDINE HCL, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
(2R)-2-[2-(trifluoromethyl)phenyl]pyrrolidine;hydrochloride (CAS 1391384-41-0) is a chemical compound with the molecular formula C11H13ClF3N and a molecular weight of 251.67 g/mol. IUPAC name: (2R)-2-[2-(trifluoromethyl)phenyl]pyrrolidine;hydrochloride. InChIKey: APDMORWJFZBMEX-HNCPQSOCSA-N.
| Molecular formula | C11H13ClF3N |
|---|---|
| Molecular weight | 251.67 g/mol |
| IUPAC name | (2R)-2-[2-(trifluoromethyl)phenyl]pyrrolidine;hydrochloride |
| InChIKey | APDMORWJFZBMEX-HNCPQSOCSA-N |
| SMILES | C1C[C@@H](NC1)C2=CC=CC=C2C(F)(F)F.Cl |
Computed by PubChem (NCBI)