CAS 1189461-56-0 appears in our catalog under these names: Harman-13C2,15N, 98% 98%atom%13C,98%atom%15N, Harman-13C2,15N, >95% (HPLC), Harman-13C2,15N. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg, 10 mg.
1-methyl-9H-(5,6-13C2,115N)pyridino[3,4-b]indole (CAS 1189461-56-0) is a chemical compound with the molecular formula C12H10N2 and a molecular weight of 185.20 g/mol. IUPAC name: 1-methyl-9H-(5,6-13C2,115N)pyridino[3,4-b]indole. InChIKey: PSFDQSOCUJVVGF-NSFXFQGJSA-N.
| Molecular formula | C12H10N2 |
|---|---|
| Molecular weight | 185.20 g/mol |
| IUPAC name | 1-methyl-9H-(5,6-13C2,115N)pyridino[3,4-b]indole |
| InChIKey | PSFDQSOCUJVVGF-NSFXFQGJSA-N |
| SMILES | CC1=[15N][13CH]=[13CH]C2=C1NC3=CC=CC=C32 |
Computed by PubChem (NCBI)