Products 1216708-84-7
CAS 1216708-84-7 is the registry number for Harman-d3. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(trideuteriomethyl)-9H-pyrido[3,4-b]indole (CAS 1216708-84-7) is a chemical compound with the molecular formula C12H10N2 and a molecular weight of 185.24 g/mol. IUPAC name: 1-(trideuteriomethyl)-9H-pyrido[3,4-b]indole. InChIKey: PSFDQSOCUJVVGF-FIBGUPNXSA-N.
| Molecular formula | C12H10N2 |
|---|---|
| Molecular weight | 185.24 g/mol |
| IUPAC name | 1-(trideuteriomethyl)-9H-pyrido[3,4-b]indole |
| InChIKey | PSFDQSOCUJVVGF-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=NC=CC2=C1NC3=CC=CC=C23 |
Computed by PubChem (NCBI)