CAS 1189465-04-0 is the registry number for 1-(2-Pyridinyl)benzotriazole-15N3. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg, 25 mg.
1-(2-pyridinyl)benzotriazole (CAS 1189465-04-0) is a chemical compound with the molecular formula C11H8N4 and a molecular weight of 199.19 g/mol. IUPAC name: 1-(2-pyridinyl)benzotriazole. InChIKey: CPWBWUGSSFRASR-OYMGSPLNSA-N.
| Molecular formula | C11H8N4 |
|---|---|
| Molecular weight | 199.19 g/mol |
| IUPAC name | 1-(2-pyridinyl)benzotriazole |
| InChIKey | CPWBWUGSSFRASR-OYMGSPLNSA-N |
| SMILES | C1=CC=C2C(=C1)[15N]=N[15N]2C3=CC=CC=[15N]3 |
Computed by PubChem (NCBI)