Products 1189465-04-0

CAS 1189465-04-0 is the registry number for 1-(2-Pyridinyl)benzotriazole-15N3. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg, 25 mg.

Structural formula: {0} (CAS {1})

1-(2-pyridinyl)benzotriazole (CAS 1189465-04-0) is a chemical compound with the molecular formula C11H8N4 and a molecular weight of 199.19 g/mol. IUPAC name: 1-(2-pyridinyl)benzotriazole. InChIKey: CPWBWUGSSFRASR-OYMGSPLNSA-N.

Identity
Molecular formulaC11H8N4
Molecular weight199.19 g/mol
IUPAC name1-(2-pyridinyl)benzotriazole
InChIKeyCPWBWUGSSFRASR-OYMGSPLNSA-N
SMILESC1=CC=C2C(=C1)[15N]=N[15N]2C3=CC=CC=[15N]3

Computed by PubChem (NCBI)