CAS 129303-82-8 appears in our catalog under these names: 1-Phenyl-1H-(1,2,3)triazolo(4,5-c)pyridine, 95%, 1-Phenyl-1H-(1,2,3)triazolo(4,5-c)pyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-phenyltriazolo[4,5-c]pyridine (CAS 129303-82-8) is a chemical compound with the molecular formula C11H8N4 and a molecular weight of 196.21 g/mol. IUPAC name: 1-phenyltriazolo[4,5-c]pyridine. InChIKey: PFELYOBDSJCMAM-UHFFFAOYSA-N.
| Molecular formula | C11H8N4 |
|---|---|
| Molecular weight | 196.21 g/mol |
| IUPAC name | 1-phenyltriazolo[4,5-c]pyridine |
| InChIKey | PFELYOBDSJCMAM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C=NC=C3)N=N2 |
Computed by PubChem (NCBI)