CAS 66571-30-0 is the registry number for 1-(Pyridin-4-yl)-1H-benzo[d][1,2,3]triazole, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
1-pyridin-4-ylbenzotriazole (CAS 66571-30-0) is a chemical compound with the molecular formula C11H8N4 and a molecular weight of 196.21 g/mol. IUPAC name: 1-pyridin-4-ylbenzotriazole. InChIKey: VYPSCVFMEKLKGG-UHFFFAOYSA-N.
| Molecular formula | C11H8N4 |
|---|---|
| Molecular weight | 196.21 g/mol |
| IUPAC name | 1-pyridin-4-ylbenzotriazole |
| InChIKey | VYPSCVFMEKLKGG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=NN2C3=CC=NC=C3 |
Computed by PubChem (NCBI)