CAS 50627-25-3 appears in our catalog under these names: 3–Amino–6–phenylpyrazine–2–carbonitrile, 3-Amino-6-phenylpyrazine-2-carbonitrile, 95+%. Offered by: GLPBio, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
3-amino-6-phenylpyrazine-2-carbonitrile (CAS 50627-25-3) is a chemical compound with the molecular formula C11H8N4 and a molecular weight of 196.21 g/mol. IUPAC name: 3-amino-6-phenylpyrazine-2-carbonitrile. InChIKey: RQDOXXBRLVPOOD-UHFFFAOYSA-N.
| Molecular formula | C11H8N4 |
|---|---|
| Molecular weight | 196.21 g/mol |
| IUPAC name | 3-amino-6-phenylpyrazine-2-carbonitrile |
| InChIKey | RQDOXXBRLVPOOD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(C(=N2)C#N)N |
Computed by PubChem (NCBI)