CAS 18346-05-9 is the registry number for 7-Phenyl-7H-purine. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
7-phenylpurine (CAS 18346-05-9) is a chemical compound with the molecular formula C11H8N4 and a molecular weight of 196.21 g/mol. IUPAC name: 7-phenylpurine. InChIKey: FQKCFGHHLWMSSS-UHFFFAOYSA-N.
| Molecular formula | C11H8N4 |
|---|---|
| Molecular weight | 196.21 g/mol |
| IUPAC name | 7-phenylpurine |
| InChIKey | FQKCFGHHLWMSSS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=NC3=NC=NC=C32 |
Computed by PubChem (NCBI)