Products 1189467-93-3
CAS 1189467-93-3 appears in our catalog under these names: 2,6-Di-iso-propylphenol-d18, 98 atom % D, min 97% Chemical Purity, Propofol–d18, Propofol-d18, 96.98%, D18-2,6-Diisopropylphenol. Offered by: CDN, GLPBio, MedChemExpress, HPC Standards. Available pack sizes: 0,1g, 0,05g, 1mg, 10mg, 5mg, 5 mg, 10mM/1mL, 10 mg.
1,2,3-trideuterio-5-deuteriooxy-4,6-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)benzene (CAS 1189467-93-3) is a chemical compound with the molecular formula C12H18O and a molecular weight of 196.38 g/mol. IUPAC name: 1,2,3-trideuterio-5-deuteriooxy-4,6-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)benzene. InChIKey: OLBCVFGFOZPWHH-YXZMVERASA-N.
| Molecular formula | C12H18O |
|---|---|
| Molecular weight | 196.38 g/mol |
| IUPAC name | 1,2,3-trideuterio-5-deuteriooxy-4,6-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)benzene |
| InChIKey | OLBCVFGFOZPWHH-YXZMVERASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])O[2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)