CAS 2514564-65-7 appears in our catalog under these names: Propofol-d14, >95% (HPLC), Propofol-d14. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
2,6-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)phenol (CAS 2514564-65-7) is a chemical compound with the molecular formula C12H18O and a molecular weight of 192.36 g/mol. IUPAC name: 2,6-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)phenol. InChIKey: OLBCVFGFOZPWHH-FNBLOHCXSA-N.
| Molecular formula | C12H18O |
|---|---|
| Molecular weight | 192.36 g/mol |
| IUPAC name | 2,6-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)phenol |
| InChIKey | OLBCVFGFOZPWHH-FNBLOHCXSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C1=C(C(=CC=C1)C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)