Products 1261393-54-7
CAS 1261393-54-7 appears in our catalog under these names: Propofol-d17, Propofol-d17, >95% (GC), Propofol-d17, 98.90%. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 1mg, 2,5mg, 5mg, 2mg, 25mg, 10mg, 1 mg.
3,4,5-trideuterio-2,6-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)phenol (CAS 1261393-54-7) is a chemical compound with the molecular formula C12H18O and a molecular weight of 195.37 g/mol. IUPAC name: 3,4,5-trideuterio-2,6-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)phenol. InChIKey: OLBCVFGFOZPWHH-ACWNEFEHSA-N.
| Molecular formula | C12H18O |
|---|---|
| Molecular weight | 195.37 g/mol |
| IUPAC name | 3,4,5-trideuterio-2,6-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)phenol |
| InChIKey | OLBCVFGFOZPWHH-ACWNEFEHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])O)C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)