CAS 1189656-64-1 appears in our catalog under these names: 4′-Hydroxydiclofenac-13C6, 98% 98%atom%13C, 4’-Hydroxy Diclofenac-13C6 (Contain 3% unlabeled), >95% (HPLC), 4’-Hydroxy diclofenac-13C6, 4'-Hydroxy diclofenac-13C6, 0.993%. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 2mg, 5mg, 1 mg.
2-[6-(2,6-dichloro-4-hydroxyanilino)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]acetic acid (CAS 1189656-64-1) is a chemical compound with the molecular formula C14H11Cl2NO3 and a molecular weight of 318.10 g/mol. IUPAC name: 2-[6-(2,6-dichloro-4-hydroxyanilino)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]acetic acid. InChIKey: KGVXVPRLBMWZLG-OLWCKNASSA-N.
| Molecular formula | C14H11Cl2NO3 |
|---|---|
| Molecular weight | 318.10 g/mol |
| IUPAC name | 2-[6-(2,6-dichloro-4-hydroxyanilino)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]acetic acid |
| InChIKey | KGVXVPRLBMWZLG-OLWCKNASSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)N[13C]2=[13CH][13CH]=[13CH][13CH]=[13C]2CC(=O)O)Cl)O |
Computed by PubChem (NCBI)