Products 1189663-45-3

CAS 1189663-45-3 is the registry number for 3-Hydroxymethyl Meclofenamic Acid-d4. Offered by: TRC. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

2,3,4,5-tetradeuterio-6-[2,6-dichloro-3-(hydroxymethyl)anilino]benzoic acid (CAS 1189663-45-3) is a chemical compound with the molecular formula C14H11Cl2NO3 and a molecular weight of 316.2 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-[2,6-dichloro-3-(hydroxymethyl)anilino]benzoic acid. InChIKey: SMILHFIJFWZZIM-RHQRLBAQSA-N.

Identity
Molecular formulaC14H11Cl2NO3
Molecular weight316.2 g/mol
IUPAC name2,3,4,5-tetradeuterio-6-[2,6-dichloro-3-(hydroxymethyl)anilino]benzoic acid
InChIKeySMILHFIJFWZZIM-RHQRLBAQSA-N
SMILES[2H]C1=C(C(=C(C(=C1[2H])C(=O)O)NC2=C(C=CC(=C2Cl)CO)Cl)[2H])[2H]

Computed by PubChem (NCBI)