CAS 1189663-45-3 is the registry number for 3-Hydroxymethyl Meclofenamic Acid-d4. Offered by: TRC. Available pack sizes: 100mg.
2,3,4,5-tetradeuterio-6-[2,6-dichloro-3-(hydroxymethyl)anilino]benzoic acid (CAS 1189663-45-3) is a chemical compound with the molecular formula C14H11Cl2NO3 and a molecular weight of 316.2 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-[2,6-dichloro-3-(hydroxymethyl)anilino]benzoic acid. InChIKey: SMILHFIJFWZZIM-RHQRLBAQSA-N.
| Molecular formula | C14H11Cl2NO3 |
|---|---|
| Molecular weight | 316.2 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-[2,6-dichloro-3-(hydroxymethyl)anilino]benzoic acid |
| InChIKey | SMILHFIJFWZZIM-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)NC2=C(C=CC(=C2Cl)CO)Cl)[2H])[2H] |
Computed by PubChem (NCBI)