CAS 67318-61-0 is the registry number for 3-Hydroxymethyl Meclofenamic Acid. Offered by: TRC. Available pack sizes: 25mg.
2-[2,6-dichloro-3-(hydroxymethyl)anilino]benzoic acid (CAS 67318-61-0) is a chemical compound with the molecular formula C14H11Cl2NO3 and a molecular weight of 312.1 g/mol. IUPAC name: 2-[2,6-dichloro-3-(hydroxymethyl)anilino]benzoic acid. InChIKey: SMILHFIJFWZZIM-UHFFFAOYSA-N.
| Molecular formula | C14H11Cl2NO3 |
|---|---|
| Molecular weight | 312.1 g/mol |
| IUPAC name | 2-[2,6-dichloro-3-(hydroxymethyl)anilino]benzoic acid |
| InChIKey | SMILHFIJFWZZIM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NC2=C(C=CC(=C2Cl)CO)Cl |
Computed by PubChem (NCBI)