Products 67318-61-0

CAS 67318-61-0 is the registry number for 3-Hydroxymethyl Meclofenamic Acid. Offered by: TRC. Available pack sizes: 25mg.

Structural formula: {0} (CAS {1})

2-[2,6-dichloro-3-(hydroxymethyl)anilino]benzoic acid (CAS 67318-61-0) is a chemical compound with the molecular formula C14H11Cl2NO3 and a molecular weight of 312.1 g/mol. IUPAC name: 2-[2,6-dichloro-3-(hydroxymethyl)anilino]benzoic acid. InChIKey: SMILHFIJFWZZIM-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11Cl2NO3
Molecular weight312.1 g/mol
IUPAC name2-[2,6-dichloro-3-(hydroxymethyl)anilino]benzoic acid
InChIKeySMILHFIJFWZZIM-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)O)NC2=C(C=CC(=C2Cl)CO)Cl

Computed by PubChem (NCBI)