Products 944251-06-3

CAS 944251-06-3 is the registry number for Diclofenac Impurity 39. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[2-(2,6-dichloro-N-hydroxyanilino)phenyl]acetic acid (CAS 944251-06-3) is a chemical compound with the molecular formula C14H11Cl2NO3 and a molecular weight of 312.1 g/mol. IUPAC name: 2-[2-(2,6-dichloro-N-hydroxyanilino)phenyl]acetic acid. InChIKey: BMCYVFULTMDTFJ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11Cl2NO3
Molecular weight312.1 g/mol
IUPAC name2-[2-(2,6-dichloro-N-hydroxyanilino)phenyl]acetic acid
InChIKeyBMCYVFULTMDTFJ-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)CC(=O)O)N(C2=C(C=CC=C2Cl)Cl)O

Computed by PubChem (NCBI)