CAS 944251-06-3 is the registry number for Diclofenac Impurity 39. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-(2,6-dichloro-N-hydroxyanilino)phenyl]acetic acid (CAS 944251-06-3) is a chemical compound with the molecular formula C14H11Cl2NO3 and a molecular weight of 312.1 g/mol. IUPAC name: 2-[2-(2,6-dichloro-N-hydroxyanilino)phenyl]acetic acid. InChIKey: BMCYVFULTMDTFJ-UHFFFAOYSA-N.
| Molecular formula | C14H11Cl2NO3 |
|---|---|
| Molecular weight | 312.1 g/mol |
| IUPAC name | 2-[2-(2,6-dichloro-N-hydroxyanilino)phenyl]acetic acid |
| InChIKey | BMCYVFULTMDTFJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)N(C2=C(C=CC=C2Cl)Cl)O |
Computed by PubChem (NCBI)