CAS 254762-27-1 appears in our catalog under these names: 4'–Hydroxy diclofenac–d4, Diclofenac sodium Impurity 54, 4'-Hydroxy Diclofenac-d4, 4’-Hydroxy Diclofenac-D4, >95% (HPLC), 4'-Hydroxydiclofenac-d4 (phenyl-d4-acetic), 86 atom % D, min 98% Chemical Purity. Offered by: GLPBio, Chemat Brand, TRC, CDN, MedChemExpress. Available pack sizes: 1mg, on request, 0,5mg, 5mg, 0,005g, 1 mg, 10 mg, 5 mg.
2-[2,3,4,5-tetradeuterio-6-(2,6-dichloro-4-hydroxyanilino)phenyl]acetic acid (CAS 254762-27-1) is a chemical compound with the molecular formula C14H11Cl2NO3 and a molecular weight of 316.2 g/mol. IUPAC name: 2-[2,3,4,5-tetradeuterio-6-(2,6-dichloro-4-hydroxyanilino)phenyl]acetic acid. InChIKey: KGVXVPRLBMWZLG-RHQRLBAQSA-N.
| Molecular formula | C14H11Cl2NO3 |
|---|---|
| Molecular weight | 316.2 g/mol |
| IUPAC name | 2-[2,3,4,5-tetradeuterio-6-(2,6-dichloro-4-hydroxyanilino)phenyl]acetic acid |
| InChIKey | KGVXVPRLBMWZLG-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])CC(=O)O)NC2=C(C=C(C=C2Cl)O)Cl)[2H])[2H] |
Computed by PubChem (NCBI)