Products 1189699-70-4
CAS 1189699-70-4 appears in our catalog under these names: Methocarbamol-d5, Methocarbamol-d5, >95% (HPLC), Methocarbamol D5, Methocarbamol D5. Offered by: Chemat Brand, TRC, GLPBio, TargetMol, MedChemExpress. Available pack sizes: on request, 2,5mg, 25mg, 1mg, 5mg, 1 mg.
[1,1,2,3,3-pentadeuterio-2-hydroxy-3-(2-methoxyphenoxy)propyl] carbamate (CAS 1189699-70-4) is a chemical compound with the molecular formula C11H15NO5 and a molecular weight of 246.27 g/mol. IUPAC name: [1,1,2,3,3-pentadeuterio-2-hydroxy-3-(2-methoxyphenoxy)propyl] carbamate. InChIKey: GNXFOGHNGIVQEH-RORPNYJOSA-N.
| Molecular formula | C11H15NO5 |
|---|---|
| Molecular weight | 246.27 g/mol |
| IUPAC name | [1,1,2,3,3-pentadeuterio-2-hydroxy-3-(2-methoxyphenoxy)propyl] carbamate |
| InChIKey | GNXFOGHNGIVQEH-RORPNYJOSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])OC(=O)N)O)OC1=CC=CC=C1OC |
Computed by PubChem (NCBI)